About 1,2-dicyclohexyl-2,2-dimethoxyethanone
1,2-dicyclohexyl-2,2-dimethoxyethanone (PubChem CID 21326019) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,2-dicyclohexyl-2,2-dimethoxyethanone.
Molecular Properties
| Compound Name | 1,2-dicyclohexyl-2,2-dimethoxyethanone |
| PubChem CID | 21326019 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1,2-dicyclohexyl-2,2-dimethoxyethanone |
| SMILES | COC(OC)(C(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | KZDNBBJEMYZGQK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dicyclohexyl-2,2-dimethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dicyclohexyl-2,2-dimethoxyethanone?
The IUPAC name of 1,2-dicyclohexyl-2,2-dimethoxyethanone (CID 21326019) is 1,2-dicyclohexyl-2,2-dimethoxyethanone.
What is the SMILES notation for 1,2-dicyclohexyl-2,2-dimethoxyethanone?
The canonical SMILES for 1,2-dicyclohexyl-2,2-dimethoxyethanone is COC(OC)(C(=O)C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,2-dicyclohexyl-2,2-dimethoxyethanone?
The InChIKey is KZDNBBJEMYZGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h13-14H,3-12H2,1-2H3.
What are the key properties of 1,2-dicyclohexyl-2,2-dimethoxyethanone?
1,2-dicyclohexyl-2,2-dimethoxyethanone has a molecular weight of 268.40 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dicyclohexyl-2,2-dimethoxyethanone is sourced from PubChem (CID 21326019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).