C10H13ClN4S — CID 21326067
[5-(2,3-dimethylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (PubChem CID 21326067) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is [5-(2,3-dimethylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
| Compound Name | [5-(2,3-dimethylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 21326067 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [5-(2,3-dimethylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| SMILES | Cc1cccc(-c2nnc(NN)s2)c1C.Cl |
| InChI | InChI=1S/C10H12N4S.ClH/c1-6-4-3-5-8(7(6)2)9-13-14-10(12-11)15-9;/h3-5H,11H2,1-2H3,(H,12,14);1H |
| InChIKey | DNWZNNBCFVHEKV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|