About 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine
4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine (PubChem CID 2132610) has the molecular formula C25H16N4S
and a molecular weight of 404.50 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine |
| PubChem CID | 2132610 |
| Molecular Formula | C25H16N4S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2nc(-n3cnc4ccccc43)c3cc(-c4ccccc4)sc3n2)cc1 |
| InChI | InChI=1S/C25H16N4S/c1-3-9-17(10-4-1)22-15-19-24(29-16-26-20-13-7-8-14-21(20)29)27-23(28-25(19)30-22)18-11-5-2-6-12-18/h1-16H |
| InChIKey | GFVOYYVROFMMFW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine (CID 2132610) is 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine is c1ccc(-c2nc(-n3cnc4ccccc43)c3cc(-c4ccccc4)sc3n2)cc1.
What is the InChIKey of 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine?
The InChIKey is GFVOYYVROFMMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16N4S/c1-3-9-17(10-4-1)22-15-19-24(29-16-26-20-13-7-8-14-21(20)29)27-23(28-25(19)30-22)18-11-5-2-6-12-18/h1-16H.
What are the key properties of 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine?
4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine has a molecular weight of 404.50 g/mol, XLogP of 6.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzimidazol-1-yl)-2,6-diphenylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 2132610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).