C8H8F8N2O4 — CID 21326214
methyl 2-[2-(1,1-difluoro-2-imino-2-methoxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanimidate (PubChem CID 21326214) has the molecular formula C8H8F8N2O4 and a molecular weight of 348.15 g/mol. Its IUPAC name is methyl 2-[2-(1,1-difluoro-2-imino-2-methoxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanimidate.
| Compound Name | methyl 2-[2-(1,1-difluoro-2-imino-2-methoxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanimidate |
|---|---|
| PubChem CID | 21326214 |
| Molecular Formula | C8H8F8N2O4 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 2-[2-(1,1-difluoro-2-imino-2-methoxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanimidate |
| SMILES | [H]/N=C(\OC)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)/C(=N/[H])OC |
| InChI | InChI=1S/C8H8F8N2O4/c1-19-3(17)5(9,10)21-7(13,14)8(15,16)22-6(11,12)4(18)20-2/h17-18H,1-2H3/b17-3-,18-4- |
| InChIKey | BRGHFGBINNNNAS-XBMAZEBWSA-N |
| XLogP | 2.64 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|