About 2-(1,2-oxazol-3-yl)ethanethioic S-acid
2-(1,2-oxazol-3-yl)ethanethioic S-acid (PubChem CID 21326229) has the molecular formula C5H5NO2S
and a molecular weight of 143.17 g/mol. Its IUPAC name is 2-(1,2-oxazol-3-yl)ethanethioic S-acid.
Molecular Properties
| Compound Name | 2-(1,2-oxazol-3-yl)ethanethioic S-acid |
| PubChem CID | 21326229 |
| Molecular Formula | C5H5NO2S |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.00 |
| IUPAC Name | 2-(1,2-oxazol-3-yl)ethanethioic S-acid |
| SMILES | O=C(S)Cc1ccon1 |
| InChI | InChI=1S/C5H5NO2S/c7-5(9)3-4-1-2-8-6-4/h1-2H,3H2,(H,7,9) |
| InChIKey | RCMUXOYZPXPYHU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-oxazol-3-yl)ethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-oxazol-3-yl)ethanethioic S-acid?
The IUPAC name of 2-(1,2-oxazol-3-yl)ethanethioic S-acid (CID 21326229) is 2-(1,2-oxazol-3-yl)ethanethioic S-acid.
What is the SMILES notation for 2-(1,2-oxazol-3-yl)ethanethioic S-acid?
The canonical SMILES for 2-(1,2-oxazol-3-yl)ethanethioic S-acid is O=C(S)Cc1ccon1.
What is the InChIKey of 2-(1,2-oxazol-3-yl)ethanethioic S-acid?
The InChIKey is RCMUXOYZPXPYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S/c7-5(9)3-4-1-2-8-6-4/h1-2H,3H2,(H,7,9).
What are the key properties of 2-(1,2-oxazol-3-yl)ethanethioic S-acid?
2-(1,2-oxazol-3-yl)ethanethioic S-acid has a molecular weight of 143.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-oxazol-3-yl)ethanethioic S-acid is sourced from PubChem (CID 21326229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).