About (E)-N,3-dimethylpent-2-enamide
(E)-N,3-dimethylpent-2-enamide (PubChem CID 21326751) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (E)-N,3-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (E)-N,3-dimethylpent-2-enamide |
| PubChem CID | 21326751 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (E)-N,3-dimethylpent-2-enamide |
| SMILES | CC/C(C)=C/C(=O)NC |
| InChI | InChI=1S/C7H13NO/c1-4-6(2)5-7(9)8-3/h5H,4H2,1-3H3,(H,8,9)/b6-5+ |
| InChIKey | DXTNKKNHDRUDPB-AATRIKPKSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,3-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,3-dimethylpent-2-enamide?
The IUPAC name of (E)-N,3-dimethylpent-2-enamide (CID 21326751) is (E)-N,3-dimethylpent-2-enamide.
What is the SMILES notation for (E)-N,3-dimethylpent-2-enamide?
The canonical SMILES for (E)-N,3-dimethylpent-2-enamide is CC/C(C)=C/C(=O)NC.
What is the InChIKey of (E)-N,3-dimethylpent-2-enamide?
The InChIKey is DXTNKKNHDRUDPB-AATRIKPKSA-N. The full InChI is InChI=1S/C7H13NO/c1-4-6(2)5-7(9)8-3/h5H,4H2,1-3H3,(H,8,9)/b6-5+.
What are the key properties of (E)-N,3-dimethylpent-2-enamide?
(E)-N,3-dimethylpent-2-enamide has a molecular weight of 127.19 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,3-dimethylpent-2-enamide is sourced from PubChem (CID 21326751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).