About Methylbutylsiloxan
Methylbutylsiloxan (PubChem CID 21326961) has the molecular formula C5H13OSi
and a molecular weight of 117.24 g/mol.
Molecular Properties
| Compound Name | Methylbutylsiloxan |
| PubChem CID | 21326961 |
| Molecular Formula | C5H13OSi |
| Molecular Weight | 117.24 g/mol |
| Exact Mass | 117.07 |
| IUPAC Name | — |
| SMILES | CCCC[Si](C)O |
| InChI | InChI=1S/C5H13OSi/c1-3-4-5-7(2)6/h6H,3-5H2,1-2H3 |
| InChIKey | YDUZAJBZUBMFIP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Methylbutylsiloxan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methylbutylsiloxan?
The IUPAC name of Methylbutylsiloxan (CID 21326961) is not available.
What is the SMILES notation for Methylbutylsiloxan?
The canonical SMILES for Methylbutylsiloxan is CCCC[Si](C)O.
What is the InChIKey of Methylbutylsiloxan?
The InChIKey is YDUZAJBZUBMFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13OSi/c1-3-4-5-7(2)6/h6H,3-5H2,1-2H3.
What are the key properties of Methylbutylsiloxan?
Methylbutylsiloxan has a molecular weight of 117.24 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Methylbutylsiloxan is sourced from PubChem (CID 21326961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).