About 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one
5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one (PubChem CID 21327346) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 21327346 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1c(C(C)(C)C)[nH][nH]c1=O |
| InChI | InChI=1S/C8H14N2O/c1-5-6(8(2,3)4)9-10-7(5)11/h1-4H3,(H2,9,10,11) |
| InChIKey | VMOKKPLADZBNNX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one (CID 21327346) is 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one is Cc1c(C(C)(C)C)[nH][nH]c1=O.
What is the InChIKey of 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one?
The InChIKey is VMOKKPLADZBNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-5-6(8(2,3)4)9-10-7(5)11/h1-4H3,(H2,9,10,11).
What are the key properties of 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one?
5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one has a molecular weight of 154.21 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-4-methyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 21327346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).