C20H17Cl3N2O5 — CID 21327532
N-(2-benzoyl-4-nitrophenyl)-2,2,2-trichloro-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 21327532) has the molecular formula C20H17Cl3N2O5 and a molecular weight of 471.72 g/mol. Its IUPAC name is N-(2-benzoyl-4-nitrophenyl)-2,2,2-trichloro-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-(2-benzoyl-4-nitrophenyl)-2,2,2-trichloro-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 21327532 |
| Molecular Formula | C20H17Cl3N2O5 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | N-(2-benzoyl-4-nitrophenyl)-2,2,2-trichloro-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(c1ccccc1)c1cc([N+](=O)[O-])ccc1N(CC1CCCO1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H17Cl3N2O5/c21-20(22,23)19(27)24(12-15-7-4-10-30-15)17-9-8-14(25(28)29)11-16(17)18(26)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15H,4,7,10,12H2 |
| InChIKey | MAOFFSPUTXFXHM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|