C15H22N4O3 — CID 21327585
2,14-diisocyanato-1,8-diazabicyclo[6.6.1]pentadecan-15-one (PubChem CID 21327585) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2,14-diisocyanato-1,8-diazabicyclo[6.6.1]pentadecan-15-one.
| Compound Name | 2,14-diisocyanato-1,8-diazabicyclo[6.6.1]pentadecan-15-one |
|---|---|
| PubChem CID | 21327585 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2,14-diisocyanato-1,8-diazabicyclo[6.6.1]pentadecan-15-one |
| SMILES | O=C=NC1CCCCCN2CCCCCC(N=C=O)N1C2=O |
| InChI | InChI=1S/C15H22N4O3/c20-11-16-13-7-3-1-5-9-18-10-6-2-4-8-14(17-12-21)19(13)15(18)22/h13-14H,1-10H2 |
| InChIKey | RFFWRJUCESWVTK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|