C9H7Cl5 — CID 21327918
1,3,5-trichloro-2-(2,3-dichloropropyl)benzene (PubChem CID 21327918) has the molecular formula C9H7Cl5 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,3,5-trichloro-2-(2,3-dichloropropyl)benzene.
| Compound Name | 1,3,5-trichloro-2-(2,3-dichloropropyl)benzene |
|---|---|
| PubChem CID | 21327918 |
| Molecular Formula | C9H7Cl5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | 1,3,5-trichloro-2-(2,3-dichloropropyl)benzene |
| SMILES | ClCC(Cl)Cc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl5/c10-4-6(12)1-7-8(13)2-5(11)3-9(7)14/h2-3,6H,1,4H2 |
| InChIKey | DFISKDAJUBKXOL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|