About furo[2,3-c]furan-2,4-dione
furo[2,3-c]furan-2,4-dione (PubChem CID 21328105) has the molecular formula C6H2O4
and a molecular weight of 138.08 g/mol. Its IUPAC name is furo[2,3-c]furan-2,4-dione.
Molecular Properties
| Compound Name | furo[2,3-c]furan-2,4-dione |
| PubChem CID | 21328105 |
| Molecular Formula | C6H2O4 |
| Molecular Weight | 138.08 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | furo[2,3-c]furan-2,4-dione |
| SMILES | O=C1C=C2C(=O)OC=C2O1 |
| InChI | InChI=1S/C6H2O4/c7-5-1-3-4(10-5)2-9-6(3)8/h1-2H |
| InChIKey | RRHUURTVBZFSGQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.08 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|
Analyze furo[2,3-c]furan-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[2,3-c]furan-2,4-dione?
The IUPAC name of furo[2,3-c]furan-2,4-dione (CID 21328105) is furo[2,3-c]furan-2,4-dione.
What is the SMILES notation for furo[2,3-c]furan-2,4-dione?
The canonical SMILES for furo[2,3-c]furan-2,4-dione is O=C1C=C2C(=O)OC=C2O1.
What is the InChIKey of furo[2,3-c]furan-2,4-dione?
The InChIKey is RRHUURTVBZFSGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2O4/c7-5-1-3-4(10-5)2-9-6(3)8/h1-2H.
What are the key properties of furo[2,3-c]furan-2,4-dione?
furo[2,3-c]furan-2,4-dione has a molecular weight of 138.08 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[2,3-c]furan-2,4-dione is sourced from PubChem (CID 21328105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).