C19H14N4S3 — CID 2132822
2-[(4-phenyl-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-yl)methylsulfanyl]-1,3-benzothiazole (PubChem CID 2132822) has the molecular formula C19H14N4S3 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2-[(4-phenyl-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-yl)methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-phenyl-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-yl)methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2132822 |
| Molecular Formula | C19H14N4S3 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(4-phenyl-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-yl)methylsulfanyl]-1,3-benzothiazole |
| SMILES | C#CCSc1nnc(CSc2nc3ccccc3s2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H14N4S3/c1-2-12-24-18-22-21-17(23(18)14-8-4-3-5-9-14)13-25-19-20-15-10-6-7-11-16(15)26-19/h1,3-11H,12-13H2 |
| InChIKey | JEVCCJBJCORMBC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|