About (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid
(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid (PubChem CID 21328821) has the molecular formula C3H4N2O3S3
and a molecular weight of 212.28 g/mol. Its IUPAC name is (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid.
Molecular Properties
| Compound Name | (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid |
| PubChem CID | 21328821 |
| Molecular Formula | C3H4N2O3S3 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C3H4N2O3S3/c6-11(7,8)1-2-4-5-3(9)10-2/h1H2,(H,5,9)(H,6,7,8) |
| InChIKey | CWJQWLSNKNWCDJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid?
The IUPAC name of (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid (CID 21328821) is (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid.
What is the SMILES notation for (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid?
The canonical SMILES for (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid is O=S(=O)(O)Cc1n[nH]c(=S)s1.
What is the InChIKey of (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid?
The InChIKey is CWJQWLSNKNWCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O3S3/c6-11(7,8)1-2-4-5-3(9)10-2/h1H2,(H,5,9)(H,6,7,8).
What are the key properties of (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid?
(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid has a molecular weight of 212.28 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methanesulfonic acid is sourced from PubChem (CID 21328821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).