C21H18F17IO4 — CID 21328836
diethyl 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-6-iodobicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 21328836) has the molecular formula C21H18F17IO4 and a molecular weight of 784.24 g/mol. Its IUPAC name is diethyl 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-6-iodobicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | diethyl 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-6-iodobicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 21328836 |
| Molecular Formula | C21H18F17IO4 |
| Molecular Weight | 784.24 g/mol |
| Exact Mass | 784.00 |
| IUPAC Name | diethyl 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-6-iodobicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C2CC(C1C(=O)OCC)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2I |
| InChI | InChI=1S/C21H18F17IO4/c1-3-42-12(40)8-6-5-7(9(8)13(41)43-4-2)11(39)10(6)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h6-11H,3-5H2,1-2H3 |
| InChIKey | FFUBPHCXMFZFSR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.24 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|