C30H56N2O4 — CID 21330311
2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)butanedioic acid (PubChem CID 21330311) has the molecular formula C30H56N2O4 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)butanedioic acid.
| Compound Name | 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)butanedioic acid |
|---|---|
| PubChem CID | 21330311 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | 2,2-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)butanedioic acid |
| SMILES | CCC1(C)CC(C(CC(=O)O)(C(=O)O)C2CC(C)(CC)N(C)C(C)(CC)C2C)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C30H56N2O4/c1-13-26(7)17-22(20(5)28(9,15-3)31(26)11)30(25(35)36,19-24(33)34)23-18-27(8,14-2)32(12)29(10,16-4)21(23)6/h20-23H,13-19H2,1-12H3,(H,33,34)(H,35,36) |
| InChIKey | KABILTOPVKXMSN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |