About 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol
3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol (PubChem CID 21330317) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol.
Molecular Properties
| Compound Name | 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol |
| PubChem CID | 21330317 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol |
| SMILES | CCCC1(C)CC(O)C(CC)C(C)(CCC)N1 |
| InChI | InChI=1S/C15H31NO/c1-6-9-14(4)11-13(17)12(8-3)15(5,16-14)10-7-2/h12-13,16-17H,6-11H2,1-5H3 |
| InChIKey | OAGPPSQOWLLHPS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol?
The IUPAC name of 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol (CID 21330317) is 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol.
What is the SMILES notation for 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol?
The canonical SMILES for 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol is CCCC1(C)CC(O)C(CC)C(C)(CCC)N1.
What is the InChIKey of 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol?
The InChIKey is OAGPPSQOWLLHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-6-9-14(4)11-13(17)12(8-3)15(5,16-14)10-7-2/h12-13,16-17H,6-11H2,1-5H3.
What are the key properties of 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol?
3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol has a molecular weight of 241.42 g/mol, XLogP of 3.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,6-dimethyl-2,6-dipropylpiperidin-4-ol is sourced from PubChem (CID 21330317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).