C34H66N4O4 — CID 21330418
6-[carboxy-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)carbamic acid (PubChem CID 21330418) has the molecular formula C34H66N4O4 and a molecular weight of 594.93 g/mol. Its IUPAC name is 6-[carboxy-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)carbamic acid.
| Compound Name | 6-[carboxy-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)carbamic acid |
|---|---|
| PubChem CID | 21330418 |
| Molecular Formula | C34H66N4O4 |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 594.51 |
| IUPAC Name | 6-[carboxy-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)amino]hexyl-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)carbamic acid |
| SMILES | CCC1(C)CC(N(CCCCCCN(C(=O)O)C2CC(C)(CC)N(C)C(C)(CC)C2C)C(=O)O)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C34H66N4O4/c1-13-31(7)23-27(25(5)33(9,15-3)35(31)11)37(29(39)40)21-19-17-18-20-22-38(30(41)42)28-24-32(8,14-2)36(12)34(10,16-4)26(28)6/h25-28H,13-24H2,1-12H3,(H,39,40)(H,41,42) |
| InChIKey | OPQXMCARNGNXNL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|