About (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate
(2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate (PubChem CID 21330468) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate |
| PubChem CID | 21330468 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate |
| SMILES | CCC1(C)CC(OC(=O)NC)C(C)C2(CCCCC2)N1 |
| InChI | InChI=1S/C16H30N2O2/c1-5-15(3)11-13(20-14(19)17-4)12(2)16(18-15)9-7-6-8-10-16/h12-13,18H,5-11H2,1-4H3,(H,17,19) |
| InChIKey | DLYMMKWRMKIZED-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate?
The IUPAC name of (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate (CID 21330468) is (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate.
What is the SMILES notation for (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate?
The canonical SMILES for (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate is CCC1(C)CC(OC(=O)NC)C(C)C2(CCCCC2)N1.
What is the InChIKey of (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate?
The InChIKey is DLYMMKWRMKIZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2/c1-5-15(3)11-13(20-14(19)17-4)12(2)16(18-15)9-7-6-8-10-16/h12-13,18H,5-11H2,1-4H3,(H,17,19).
What are the key properties of (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate?
(2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate has a molecular weight of 282.43 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-2,5-dimethyl-1-azaspiro[5.5]undecan-4-yl) N-methylcarbamate is sourced from PubChem (CID 21330468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).