C58H98N4O8 — CID 21330487
tetrakis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 21330487) has the molecular formula C58H98N4O8 and a molecular weight of 979.44 g/mol. Its IUPAC name is tetrakis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 21330487 |
| Molecular Formula | C58H98N4O8 |
| Molecular Weight | 979.44 g/mol |
| Exact Mass | 978.74 |
| IUPAC Name | tetrakis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | CCC1(C)CC(OC(=O)c2cc(C(=O)OC3CC(C)(CC)NC(C)(CC)C3C)c(C(=O)OC3CC(C)(CC)NC(C)(CC)C3C)cc2C(=O)OC2CC(C)(CC)NC(C)(CC)C2C)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C58H98N4O8/c1-21-51(13)31-43(35(9)55(17,25-5)59-51)67-47(63)39-29-41(49(65)69-45-33-53(15,23-3)61-57(19,27-7)37(45)11)42(50(66)70-46-34-54(16,24-4)62-58(20,28-8)38(46)12)30-40(39)48(64)68-44-32-52(14,22-2)60-56(18,26-6)36(44)10/h29-30,35-38,43-46,59-62H,21-28,31-34H2,1-20H3 |
| InChIKey | MDOLSOVTZSFKGG-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.44 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|