C15H13ClN6O6S2 — CID 21330516
3-chloro-4-[[4-[2-(2-sulfophenyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 21330516) has the molecular formula C15H13ClN6O6S2 and a molecular weight of 472.89 g/mol. Its IUPAC name is 3-chloro-4-[[4-[2-(2-sulfophenyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-chloro-4-[[4-[2-(2-sulfophenyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21330516 |
| Molecular Formula | C15H13ClN6O6S2 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 3-chloro-4-[[4-[2-(2-sulfophenyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2ncnc(NNc3ccccc3S(=O)(=O)O)n2)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClN6O6S2/c16-10-7-9(29(23,24)25)5-6-11(10)19-14-17-8-18-15(20-14)22-21-12-3-1-2-4-13(12)30(26,27)28/h1-8,21H,(H,23,24,25)(H,26,27,28)(H2,17,18,19,20,22) |
| InChIKey | DYYYPHNZJRCUJT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 183.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|