C8H12N4S — CID 21330718
N-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide (PubChem CID 21330718) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is N-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide.
| Compound Name | N-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 21330718 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
| SMILES | CNC(=S)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C8H12N4S/c1-9-8(13)12-3-2-6-7(4-12)11-5-10-6/h5H,2-4H2,1H3,(H,9,13)(H,10,11) |
| InChIKey | UCMZPBLRPQBJKS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|