About 6-chlorobenzene-1,2,4-triamine
6-chlorobenzene-1,2,4-triamine (PubChem CID 21330853) has the molecular formula C6H8ClN3
and a molecular weight of 157.60 g/mol. Its IUPAC name is 6-chlorobenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 6-chlorobenzene-1,2,4-triamine |
| PubChem CID | 21330853 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 6-chlorobenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(N)c(Cl)c1 |
| InChI | InChI=1S/C6H8ClN3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,8-10H2 |
| InChIKey | YOTHKIOAMHRDGY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorobenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorobenzene-1,2,4-triamine?
The IUPAC name of 6-chlorobenzene-1,2,4-triamine (CID 21330853) is 6-chlorobenzene-1,2,4-triamine.
What is the SMILES notation for 6-chlorobenzene-1,2,4-triamine?
The canonical SMILES for 6-chlorobenzene-1,2,4-triamine is Nc1cc(N)c(N)c(Cl)c1.
What is the InChIKey of 6-chlorobenzene-1,2,4-triamine?
The InChIKey is YOTHKIOAMHRDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,8-10H2.
What are the key properties of 6-chlorobenzene-1,2,4-triamine?
6-chlorobenzene-1,2,4-triamine has a molecular weight of 157.60 g/mol, XLogP of 1.09, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorobenzene-1,2,4-triamine is sourced from PubChem (CID 21330853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).