C20H16F12N2O2 — CID 21331011
2-amino-4-[8-(3-amino-4-hydroxyphenyl)-1,1,2,2,3,3,6,6,7,7,8,8-dodecafluorooctyl]phenol (PubChem CID 21331011) has the molecular formula C20H16F12N2O2 and a molecular weight of 544.34 g/mol. Its IUPAC name is 2-amino-4-[8-(3-amino-4-hydroxyphenyl)-1,1,2,2,3,3,6,6,7,7,8,8-dodecafluorooctyl]phenol.
| Compound Name | 2-amino-4-[8-(3-amino-4-hydroxyphenyl)-1,1,2,2,3,3,6,6,7,7,8,8-dodecafluorooctyl]phenol |
|---|---|
| PubChem CID | 21331011 |
| Molecular Formula | C20H16F12N2O2 |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-amino-4-[8-(3-amino-4-hydroxyphenyl)-1,1,2,2,3,3,6,6,7,7,8,8-dodecafluorooctyl]phenol |
| SMILES | Nc1cc(C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)C(F)(F)C(F)(F)c2ccc(O)c(N)c2)ccc1O |
| InChI | InChI=1S/C20H16F12N2O2/c21-15(22,19(29,30)17(25,26)9-1-3-13(35)11(33)7-9)5-6-16(23,24)20(31,32)18(27,28)10-2-4-14(36)12(34)8-10/h1-4,7-8,35-36H,5-6,33-34H2 |
| InChIKey | GCPRBMZJKBQJRE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|