C6H10N4OS — CID 21331059
N,N-dimethyl-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetamide (PubChem CID 21331059) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 21331059 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | N,N-dimethyl-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetamide |
| SMILES | CN(C)C(=O)Cc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H10N4OS/c1-10(2)5(11)3-4-7-6(12)9-8-4/h3H2,1-2H3,(H2,7,8,9,12) |
| InChIKey | WKMVLTAIWUDJEW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|