About 6-fluoro-1,3-benzothiazine-2,4-dione
6-fluoro-1,3-benzothiazine-2,4-dione (PubChem CID 21331308) has the molecular formula C8H4FNO2S
and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-fluoro-1,3-benzothiazine-2,4-dione.
Molecular Properties
| Compound Name | 6-fluoro-1,3-benzothiazine-2,4-dione |
| PubChem CID | 21331308 |
| Molecular Formula | C8H4FNO2S |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 6-fluoro-1,3-benzothiazine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(F)ccc2s1 |
| InChI | InChI=1S/C8H4FNO2S/c9-4-1-2-6-5(3-4)7(11)10-8(12)13-6/h1-3H,(H,10,11,12) |
| InChIKey | CEGBPMUHHILBGY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1,3-benzothiazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,3-benzothiazine-2,4-dione?
The IUPAC name of 6-fluoro-1,3-benzothiazine-2,4-dione (CID 21331308) is 6-fluoro-1,3-benzothiazine-2,4-dione.
What is the SMILES notation for 6-fluoro-1,3-benzothiazine-2,4-dione?
The canonical SMILES for 6-fluoro-1,3-benzothiazine-2,4-dione is O=c1[nH]c(=O)c2cc(F)ccc2s1.
What is the InChIKey of 6-fluoro-1,3-benzothiazine-2,4-dione?
The InChIKey is CEGBPMUHHILBGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO2S/c9-4-1-2-6-5(3-4)7(11)10-8(12)13-6/h1-3H,(H,10,11,12).
What are the key properties of 6-fluoro-1,3-benzothiazine-2,4-dione?
6-fluoro-1,3-benzothiazine-2,4-dione has a molecular weight of 197.19 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,3-benzothiazine-2,4-dione is sourced from PubChem (CID 21331308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).