About 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine
2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 21331922) has the molecular formula C12H4Br2F5N3O2
and a molecular weight of 476.98 g/mol. Its IUPAC name is 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine.
Molecular Properties
| Compound Name | 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine |
| PubChem CID | 21331922 |
| Molecular Formula | C12H4Br2F5N3O2 |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 474.86 |
| IUPAC Name | 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2c(F)c(Br)nc(Br)c2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H4Br2F5N3O2/c13-10-7(15)9(8(16)11(14)21-10)20-6-2-1-4(22(23)24)3-5(6)12(17,18)19/h1-3H,(H,20,21) |
| InChIKey | CBQZFONTAWZQOU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine?
The IUPAC name of 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine (CID 21331922) is 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine.
What is the SMILES notation for 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine?
The canonical SMILES for 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine is O=[N+]([O-])c1ccc(Nc2c(F)c(Br)nc(Br)c2F)c(C(F)(F)F)c1.
What is the InChIKey of 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine?
The InChIKey is CBQZFONTAWZQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Br2F5N3O2/c13-10-7(15)9(8(16)11(14)21-10)20-6-2-1-4(22(23)24)3-5(6)12(17,18)19/h1-3H,(H,20,21).
What are the key properties of 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine?
2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine has a molecular weight of 476.98 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-3,5-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine is sourced from PubChem (CID 21331922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).