About 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride
1-N'-cyclohexylpropane-1,1-diamine;hydrochloride (PubChem CID 21332734) has the molecular formula C9H21ClN2
and a molecular weight of 192.73 g/mol. Its IUPAC name is 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride |
| PubChem CID | 21332734 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride |
| SMILES | CCC(N)NC1CCCCC1.Cl |
| InChI | InChI=1S/C9H20N2.ClH/c1-2-9(10)11-8-6-4-3-5-7-8;/h8-9,11H,2-7,10H2,1H3;1H |
| InChIKey | FDEUPVRGZZDQNA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride?
The IUPAC name of 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride (CID 21332734) is 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride.
What is the SMILES notation for 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride?
The canonical SMILES for 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride is CCC(N)NC1CCCCC1.Cl.
What is the InChIKey of 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride?
The InChIKey is FDEUPVRGZZDQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.ClH/c1-2-9(10)11-8-6-4-3-5-7-8;/h8-9,11H,2-7,10H2,1H3;1H.
What are the key properties of 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride?
1-N'-cyclohexylpropane-1,1-diamine;hydrochloride has a molecular weight of 192.73 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-cyclohexylpropane-1,1-diamine;hydrochloride is sourced from PubChem (CID 21332734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).