About 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride
1-N'-cyclohexylethane-1,1-diamine;dihydrochloride (PubChem CID 21332758) has the molecular formula C8H20Cl2N2
and a molecular weight of 215.17 g/mol. Its IUPAC name is 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride |
| PubChem CID | 21332758 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride |
| SMILES | CC(N)NC1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-7(9)10-8-5-3-2-4-6-8;;/h7-8,10H,2-6,9H2,1H3;2*1H |
| InChIKey | OGOLBZAIALZCMM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride?
The IUPAC name of 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride (CID 21332758) is 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride.
What is the SMILES notation for 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride?
The canonical SMILES for 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride is CC(N)NC1CCCCC1.Cl.Cl.
What is the InChIKey of 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride?
The InChIKey is OGOLBZAIALZCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2ClH/c1-7(9)10-8-5-3-2-4-6-8;;/h7-8,10H,2-6,9H2,1H3;2*1H.
What are the key properties of 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride?
1-N'-cyclohexylethane-1,1-diamine;dihydrochloride has a molecular weight of 215.17 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-cyclohexylethane-1,1-diamine;dihydrochloride is sourced from PubChem (CID 21332758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).