About 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol
1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol (PubChem CID 21332842) has the molecular formula C23H40O
and a molecular weight of 332.57 g/mol. Its IUPAC name is 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol.
Molecular Properties
| Compound Name | 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol |
| PubChem CID | 21332842 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol |
| SMILES | CC1(C)C2CCC(C2)C1CCC(O)CCC1C2CCC(C2)C1(C)C |
| InChI | InChI=1S/C23H40O/c1-22(2)17-7-5-15(13-17)20(22)11-9-19(24)10-12-21-16-6-8-18(14-16)23(21,3)4/h15-21,24H,5-14H2,1-4H3 |
| InChIKey | QITQPGGYTQMNJT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol?
The IUPAC name of 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol (CID 21332842) is 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol.
What is the SMILES notation for 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol?
The canonical SMILES for 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol is CC1(C)C2CCC(C2)C1CCC(O)CCC1C2CCC(C2)C1(C)C.
What is the InChIKey of 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol?
The InChIKey is QITQPGGYTQMNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O/c1-22(2)17-7-5-15(13-17)20(22)11-9-19(24)10-12-21-16-6-8-18(14-16)23(21,3)4/h15-21,24H,5-14H2,1-4H3.
What are the key properties of 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol?
1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol has a molecular weight of 332.57 g/mol, XLogP of 6.05, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-3-ol is sourced from PubChem (CID 21332842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).