About cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate
cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate (PubChem CID 21333327) has the molecular formula C27H18F2N2O2
and a molecular weight of 440.45 g/mol. Its IUPAC name is cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate |
| PubChem CID | 21333327 |
| Molecular Formula | C27H18F2N2O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate |
| SMILES | N#CCOC(=O)c1ccc(Cc2cccc(-c3ccc(F)cc3)c2-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C27H18F2N2O2/c28-22-9-5-19(6-10-22)24-3-1-2-21(26(24)20-7-11-23(29)12-8-20)16-18-4-13-25(31-17-18)27(32)33-15-14-30/h1-13,17H,15-16H2 |
| InChIKey | DHXICYRDBNEBPG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate?
The IUPAC name of cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate (CID 21333327) is cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate.
What is the SMILES notation for cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate?
The canonical SMILES for cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate is N#CCOC(=O)c1ccc(Cc2cccc(-c3ccc(F)cc3)c2-c2ccc(F)cc2)cn1.
What is the InChIKey of cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate?
The InChIKey is DHXICYRDBNEBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18F2N2O2/c28-22-9-5-19(6-10-22)24-3-1-2-21(26(24)20-7-11-23(29)12-8-20)16-18-4-13-25(31-17-18)27(32)33-15-14-30/h1-13,17H,15-16H2.
What are the key properties of cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate?
cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate has a molecular weight of 440.45 g/mol, XLogP of 5.96, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 5-[[2,3-bis(4-fluorophenyl)phenyl]methyl]pyridine-2-carboxylate is sourced from PubChem (CID 21333327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).