About 4-phenylthiomorpholine;pyrrolidine
4-phenylthiomorpholine;pyrrolidine (PubChem CID 21333601) has the molecular formula C14H22N2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-phenylthiomorpholine;pyrrolidine.
Molecular Properties
| Compound Name | 4-phenylthiomorpholine;pyrrolidine |
| PubChem CID | 21333601 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-phenylthiomorpholine;pyrrolidine |
| SMILES | C1CCNC1.c1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C10H13NS.C4H9N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-4-5-3-1/h1-5H,6-9H2;5H,1-4H2 |
| InChIKey | IPBIDRPXJJTDTJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylthiomorpholine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylthiomorpholine;pyrrolidine?
The IUPAC name of 4-phenylthiomorpholine;pyrrolidine (CID 21333601) is 4-phenylthiomorpholine;pyrrolidine.
What is the SMILES notation for 4-phenylthiomorpholine;pyrrolidine?
The canonical SMILES for 4-phenylthiomorpholine;pyrrolidine is C1CCNC1.c1ccc(N2CCSCC2)cc1.
What is the InChIKey of 4-phenylthiomorpholine;pyrrolidine?
The InChIKey is IPBIDRPXJJTDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS.C4H9N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-4-5-3-1/h1-5H,6-9H2;5H,1-4H2.
What are the key properties of 4-phenylthiomorpholine;pyrrolidine?
4-phenylthiomorpholine;pyrrolidine has a molecular weight of 250.41 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylthiomorpholine;pyrrolidine is sourced from PubChem (CID 21333601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).