About 2-propan-2-yloxy-1,3-thiazole
2-propan-2-yloxy-1,3-thiazole (PubChem CID 21334097) has the molecular formula C6H9NOS
and a molecular weight of 143.21 g/mol. Its IUPAC name is 2-propan-2-yloxy-1,3-thiazole.
Molecular Properties
| Compound Name | 2-propan-2-yloxy-1,3-thiazole |
| PubChem CID | 21334097 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 2-propan-2-yloxy-1,3-thiazole |
| SMILES | CC(C)Oc1nccs1 |
| InChI | InChI=1S/C6H9NOS/c1-5(2)8-6-7-3-4-9-6/h3-5H,1-2H3 |
| InChIKey | XLGQNBBTOJCPMG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yloxy-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxy-1,3-thiazole?
The IUPAC name of 2-propan-2-yloxy-1,3-thiazole (CID 21334097) is 2-propan-2-yloxy-1,3-thiazole.
What is the SMILES notation for 2-propan-2-yloxy-1,3-thiazole?
The canonical SMILES for 2-propan-2-yloxy-1,3-thiazole is CC(C)Oc1nccs1.
What is the InChIKey of 2-propan-2-yloxy-1,3-thiazole?
The InChIKey is XLGQNBBTOJCPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NOS/c1-5(2)8-6-7-3-4-9-6/h3-5H,1-2H3.
What are the key properties of 2-propan-2-yloxy-1,3-thiazole?
2-propan-2-yloxy-1,3-thiazole has a molecular weight of 143.21 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxy-1,3-thiazole is sourced from PubChem (CID 21334097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).