About ethylboronamidic acid
ethylboronamidic acid (PubChem CID 21334156) has the molecular formula C2H8BNO
and a molecular weight of 72.90 g/mol. Its IUPAC name is ethylboronamidic acid.
Molecular Properties
| Compound Name | ethylboronamidic acid |
| PubChem CID | 21334156 |
| Molecular Formula | C2H8BNO |
| Molecular Weight | 72.90 g/mol |
| Exact Mass | 73.07 |
| IUPAC Name | ethylboronamidic acid |
| SMILES | CCB(N)O |
| InChI | InChI=1S/C2H8BNO/c1-2-3(4)5/h5H,2,4H2,1H3 |
| InChIKey | SWEQYFJNNNXCOS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.90 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylboronamidic acid?
The IUPAC name of ethylboronamidic acid (CID 21334156) is ethylboronamidic acid.
What is the SMILES notation for ethylboronamidic acid?
The canonical SMILES for ethylboronamidic acid is CCB(N)O.
What is the InChIKey of ethylboronamidic acid?
The InChIKey is SWEQYFJNNNXCOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8BNO/c1-2-3(4)5/h5H,2,4H2,1H3.
What are the key properties of ethylboronamidic acid?
ethylboronamidic acid has a molecular weight of 72.90 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylboronamidic acid is sourced from PubChem (CID 21334156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).