C12H14N2O — CID 21334340
(Z)-1-(1,2-dimethylbenzimidazol-4-yl)prop-1-en-1-ol (PubChem CID 21334340) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (Z)-1-(1,2-dimethylbenzimidazol-4-yl)prop-1-en-1-ol.
| Compound Name | (Z)-1-(1,2-dimethylbenzimidazol-4-yl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 21334340 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (Z)-1-(1,2-dimethylbenzimidazol-4-yl)prop-1-en-1-ol |
| SMILES | C/C=C(\O)c1cccc2c1nc(C)n2C |
| InChI | InChI=1S/C12H14N2O/c1-4-11(15)9-6-5-7-10-12(9)13-8(2)14(10)3/h4-7,15H,1-3H3/b11-4- |
| InChIKey | KUCRDTDRJNFAKK-WCIBSUBMSA-N |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|