About 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine
1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine (PubChem CID 21334587) has the molecular formula C11H24N4
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine |
| PubChem CID | 21334587 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCC1CCC(CN)CC1 |
| InChI | InChI=1S/C11H24N4/c1-13-11(14-2)15-8-10-5-3-9(7-12)4-6-10/h9-10H,3-8,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | PDNAKNCKXFEHKH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine?
The IUPAC name of 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine (CID 21334587) is 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine.
What is the SMILES notation for 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine?
The canonical SMILES for 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine is C/N=C(\NC)NCC1CCC(CN)CC1.
What is the InChIKey of 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine?
The InChIKey is PDNAKNCKXFEHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4/c1-13-11(14-2)15-8-10-5-3-9(7-12)4-6-10/h9-10H,3-8,12H2,1-2H3,(H2,13,14,15).
What are the key properties of 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine?
1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine has a molecular weight of 212.34 g/mol, XLogP of 0.55, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(aminomethyl)cyclohexyl]methyl]-2,3-dimethylguanidine is sourced from PubChem (CID 21334587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).