About 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid
2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid (PubChem CID 21335001) has the molecular formula C16H30O5Si
and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid |
| PubChem CID | 21335001 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid |
| SMILES | CC(=O)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)C[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C16H30O5Si/c1-11(17)20-13-7-12(9-15(18)19)8-14(10-13)21-22(5,6)16(2,3)4/h12-14H,7-10H2,1-6H3,(H,18,19)/t12-,13+,14?/m0/s1 |
| InChIKey | OAJNMAOQMYTKQR-WLDKUNSKSA-N |
| XLogP | 3.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid?
The IUPAC name of 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid (CID 21335001) is 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid.
What is the SMILES notation for 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid?
The canonical SMILES for 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid is CC(=O)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)C[C@@H](CC(=O)O)C1.
What is the InChIKey of 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid?
The InChIKey is OAJNMAOQMYTKQR-WLDKUNSKSA-N. The full InChI is InChI=1S/C16H30O5Si/c1-11(17)20-13-7-12(9-15(18)19)8-14(10-13)21-22(5,6)16(2,3)4/h12-14H,7-10H2,1-6H3,(H,18,19)/t12-,13+,14?/m0/s1.
What are the key properties of 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid?
2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid has a molecular weight of 330.50 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetic acid is sourced from PubChem (CID 21335001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).