About CID 21335028
CID 21335028 (PubChem CID 21335028) has the molecular formula C9H15B
and a molecular weight of 134.03 g/mol.
Molecular Properties
| Compound Name | CID 21335028 |
| PubChem CID | 21335028 |
| Molecular Formula | C9H15B |
| Molecular Weight | 134.03 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | — |
| SMILES | [B]/C(C)=C(\C)C(C)=C(C)C |
| InChI | InChI=1S/C9H15B/c1-6(2)7(3)8(4)9(5)10/h1-5H3/b9-8+ |
| InChIKey | WEKYEKFXQGTUKX-CMDGGOBGSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 21335028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21335028?
The IUPAC name of CID 21335028 (CID 21335028) is not available.
What is the SMILES notation for CID 21335028?
The canonical SMILES for CID 21335028 is [B]/C(C)=C(\C)C(C)=C(C)C.
What is the InChIKey of CID 21335028?
The InChIKey is WEKYEKFXQGTUKX-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H15B/c1-6(2)7(3)8(4)9(5)10/h1-5H3/b9-8+.
What are the key properties of CID 21335028?
CID 21335028 has a molecular weight of 134.03 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21335028 is sourced from PubChem (CID 21335028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).