C14H11F3N2O2S2 — CID 2133550
N-[4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 2133550) has the molecular formula C14H11F3N2O2S2 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 2133550 |
| Molecular Formula | C14H11F3N2O2S2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN1C(=O)/C(=C\c2ccc(NC(=O)C(F)(F)F)cc2)SC1=S |
| InChI | InChI=1S/C14H11F3N2O2S2/c1-2-19-11(20)10(23-13(19)22)7-8-3-5-9(6-4-8)18-12(21)14(15,16)17/h3-7H,2H2,1H3,(H,18,21)/b10-7+ |
| InChIKey | JTHOBWWJEBINPW-JXMROGBWSA-N |
| XLogP | 3.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|