C12H18NW3- — CID 21335576
methyl-(2,3,4,5,6-pentamethylphenyl)azanide;tungsten (PubChem CID 21335576) has the molecular formula C12H18NW3- and a molecular weight of 727.80 g/mol. Its IUPAC name is methyl-(2,3,4,5,6-pentamethylphenyl)azanide;tungsten.
| Compound Name | methyl-(2,3,4,5,6-pentamethylphenyl)azanide;tungsten |
|---|---|
| PubChem CID | 21335576 |
| Molecular Formula | C12H18NW3- |
| Molecular Weight | 727.80 g/mol |
| Exact Mass | 728.00 |
| IUPAC Name | methyl-(2,3,4,5,6-pentamethylphenyl)azanide;tungsten |
| SMILES | C[N-]c1c(C)c(C)c(C)c(C)c1C.[W].[W].[W] |
| InChI | InChI=1S/C12H18N.3W/c1-7-8(2)10(4)12(13-6)11(5)9(7)3;;;/h1-6H3;;;/q-1;;; |
| InChIKey | VMWOTMZWNSKJAN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |