About 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid
2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid (PubChem CID 21335618) has the molecular formula C14H18O7
and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid |
| PubChem CID | 21335618 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid |
| SMILES | C=C(C)C(=O)C1OC(C(=O)C(C)C)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C14H18O7/c1-5(2)9(15)11-7(13(17)18)8(14(19)20)12(21-11)10(16)6(3)4/h6-8,11-12H,1H2,2-4H3,(H,17,18)(H,19,20) |
| InChIKey | ZGHRZANVEFLHJJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid?
The IUPAC name of 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid (CID 21335618) is 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid.
What is the SMILES notation for 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid?
The canonical SMILES for 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid is C=C(C)C(=O)C1OC(C(=O)C(C)C)C(C(=O)O)C1C(=O)O.
What is the InChIKey of 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid?
The InChIKey is ZGHRZANVEFLHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O7/c1-5(2)9(15)11-7(13(17)18)8(14(19)20)12(21-11)10(16)6(3)4/h6-8,11-12H,1H2,2-4H3,(H,17,18)(H,19,20).
What are the key properties of 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid?
2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid has a molecular weight of 298.29 g/mol, XLogP of 0.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropanoyl)-5-(2-methylprop-2-enoyl)oxolane-3,4-dicarboxylic acid is sourced from PubChem (CID 21335618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).