C26H34O2 — CID 21335954
6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docosanyl 2-methylprop-2-enoate (PubChem CID 21335954) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docosanyl 2-methylprop-2-enoate.
| Compound Name | 6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docosanyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21335954 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docosanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C3CC(C21)C1C2CC(C4C5CCC(C5)C24)C31 |
| InChI | InChI=1S/C26H34O2/c1-10(2)26(27)28-19-7-13-6-14(19)23-18-9-17(22(13)23)24-15-8-16(25(18)24)21-12-4-3-11(5-12)20(15)21/h11-25H,1,3-9H2,2H3 |
| InChIKey | KLZNXSUGMDNZQM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|