C21H28O2 — CID 21335955
4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl 2-methylprop-2-enoate (PubChem CID 21335955) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl 2-methylprop-2-enoate.
| Compound Name | 4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21335955 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C3CC(C4C5CCC(C5)C34)C21 |
| InChI | InChI=1S/C21H28O2/c1-9(2)21(22)23-16-7-12-6-13(16)20-15-8-14(19(12)20)17-10-3-4-11(5-10)18(15)17/h10-20H,1,3-8H2,2H3 |
| InChIKey | UKCDFRPGCVFDIF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|