About 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate
2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate (PubChem CID 2133599) has the molecular formula C18H17NO7S
and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate |
| PubChem CID | 2133599 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)OCCN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H17NO7S/c1-24-15-8-7-12(11-16(15)25-2)27(22,23)26-10-9-19-17(20)13-5-3-4-6-14(13)18(19)21/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | LCZGWILEEZTEJK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate (CID 2133599) is 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate is COc1ccc(S(=O)(=O)OCCN2C(=O)c3ccccc3C2=O)cc1OC.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate?
The InChIKey is LCZGWILEEZTEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO7S/c1-24-15-8-7-12(11-16(15)25-2)27(22,23)26-10-9-19-17(20)13-5-3-4-6-14(13)18(19)21/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate?
2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate has a molecular weight of 391.40 g/mol, XLogP of 1.71, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl 3,4-dimethoxybenzenesulfonate is sourced from PubChem (CID 2133599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).