C39H39IN3O4S- — CID 21336651
1-[2-[4-[6-benzoyliodanuidyloxy-3-[[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]imidazolidin-2-one (PubChem CID 21336651) has the molecular formula C39H39IN3O4S- and a molecular weight of 772.73 g/mol. Its IUPAC name is 1-[2-[4-[6-benzoyliodanuidyloxy-3-[[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-[6-benzoyliodanuidyloxy-3-[[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 21336651 |
| Molecular Formula | C39H39IN3O4S- |
| Molecular Weight | 772.73 g/mol |
| Exact Mass | 772.17 |
| IUPAC Name | 1-[2-[4-[6-benzoyliodanuidyloxy-3-[[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]imidazolidin-2-one |
| SMILES | Cc1cc(Cc2c(-c3ccc(OCCN4CCNC4=O)cc3)sc3cc(O[I-]C(=O)c4ccccc4)ccc23)ccc1CN1CCCC1 |
| InChI | InChI=1S/C39H39IN3O4S/c1-27-23-28(9-10-31(27)26-42-18-5-6-19-42)24-35-34-16-15-33(47-40-38(44)30-7-3-2-4-8-30)25-36(34)48-37(35)29-11-13-32(14-12-29)46-22-21-43-20-17-41-39(43)45/h2-4,7-16,23,25H,5-6,17-22,24,26H2,1H3,(H,41,45)/q-1 |
| InChIKey | XAJVNNKUXDPZBN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|