C51H39F6NO4 — CID 21337131
5-[2-(3,4-diacetylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)-3-methylphenyl]fluoren-9-yl]-2-methylphenyl]indene-1,3-dione (PubChem CID 21337131) has the molecular formula C51H39F6NO4 and a molecular weight of 843.86 g/mol. Its IUPAC name is 5-[2-(3,4-diacetylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)-3-methylphenyl]fluoren-9-yl]-2-methylphenyl]indene-1,3-dione.
| Compound Name | 5-[2-(3,4-diacetylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)-3-methylphenyl]fluoren-9-yl]-2-methylphenyl]indene-1,3-dione |
|---|---|
| PubChem CID | 21337131 |
| Molecular Formula | C51H39F6NO4 |
| Molecular Weight | 843.86 g/mol |
| Exact Mass | 843.28 |
| IUPAC Name | 5-[2-(3,4-diacetylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[9-[4-(dimethylamino)-3-methylphenyl]fluoren-9-yl]-2-methylphenyl]indene-1,3-dione |
| SMILES | CC(=O)c1ccc(C(c2ccc3c(c2)C(=O)C(c2ccc(C4(c5ccc(N(C)C)c(C)c5)c5ccccc5-c5ccccc54)cc2C)C3=O)(C(F)(F)F)C(F)(F)F)cc1C(C)=O |
| InChI | InChI=1S/C51H39F6NO4/c1-27-23-31(48(32-18-22-44(58(5)6)28(2)24-32)42-13-9-7-11-37(42)38-12-8-10-14-43(38)48)15-19-35(27)45-46(61)39-21-17-34(26-41(39)47(45)62)49(50(52,53)54,51(55,56)57)33-16-20-36(29(3)59)40(25-33)30(4)60/h7-26,45H,1-6H3 |
| InChIKey | FPFGPEQNBRLYAP-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.86 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|