C18H27F9O2 — CID 21337536
1-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)-3-(1,1,1-trifluoro-2-propan-2-yloxypropan-2-yl)cyclohexane (PubChem CID 21337536) has the molecular formula C18H27F9O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)-3-(1,1,1-trifluoro-2-propan-2-yloxypropan-2-yl)cyclohexane.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)-3-(1,1,1-trifluoro-2-propan-2-yloxypropan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 21337536 |
| Molecular Formula | C18H27F9O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)-3-(1,1,1-trifluoro-2-propan-2-yloxypropan-2-yl)cyclohexane |
| SMILES | CC(C)OC(C)(C1CCCC(C(OC(C)C)(C(F)(F)F)C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C18H27F9O2/c1-10(2)28-14(5,16(19,20)21)12-7-6-8-13(9-12)15(17(22,23)24,18(25,26)27)29-11(3)4/h10-13H,6-9H2,1-5H3 |
| InChIKey | NYNCYASDMVNMAA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |