C6H11NO — CID 21337713
2,4,5-trimethyl-2,3-dihydro-1,3-oxazole (PubChem CID 21337713) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 2,4,5-trimethyl-2,3-dihydro-1,3-oxazole.
| Compound Name | 2,4,5-trimethyl-2,3-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 21337713 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2,4,5-trimethyl-2,3-dihydro-1,3-oxazole |
| SMILES | CC1=C(C)OC(C)N1 |
| InChI | InChI=1S/C6H11NO/c1-4-5(2)8-6(3)7-4/h6-7H,1-3H3 |
| InChIKey | GMCDOSKTGHNVFQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |