C14H25N3O4 — CID 21338645
N,2,2-trimethyl-N-[1-[[1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-3-oxobutanamide (PubChem CID 21338645) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[1-[[1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-3-oxobutanamide.
| Compound Name | N,2,2-trimethyl-N-[1-[[1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-3-oxobutanamide |
|---|---|
| PubChem CID | 21338645 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N,2,2-trimethyl-N-[1-[[1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-3-oxobutanamide |
| SMILES | CNC(=O)C(C)NC(=O)C(C)N(C)C(=O)C(C)(C)C(C)=O |
| InChI | InChI=1S/C14H25N3O4/c1-8(11(19)15-6)16-12(20)9(2)17(7)13(21)14(4,5)10(3)18/h8-9H,1-7H3,(H,15,19)(H,16,20) |
| InChIKey | OKZHOMZPIRIIAF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|