C24H20F6N2O8 — CID 21338746
(2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-3,4-dihydro-2H-quinoline-1,6,7-tricarboxylic acid (PubChem CID 21338746) has the molecular formula C24H20F6N2O8 and a molecular weight of 578.42 g/mol. Its IUPAC name is (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-3,4-dihydro-2H-quinoline-1,6,7-tricarboxylic acid.
| Compound Name | (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-3,4-dihydro-2H-quinoline-1,6,7-tricarboxylic acid |
|---|---|
| PubChem CID | 21338746 |
| Molecular Formula | C24H20F6N2O8 |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-methyl-3,4-dihydro-2H-quinoline-1,6,7-tricarboxylic acid |
| SMILES | COC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C[C@@H](C)N(C(=O)O)c2cc(C(=O)O)c(C(=O)O)cc21 |
| InChI | InChI=1S/C24H20F6N2O8/c1-10-3-17(16-7-14(19(33)34)15(20(35)36)8-18(16)32(10)21(37)38)31(22(39)40-2)9-11-4-12(23(25,26)27)6-13(5-11)24(28,29)30/h4-8,10,17H,3,9H2,1-2H3,(H,33,34)(H,35,36)(H,37,38)/t10-,17+/m1/s1 |
| InChIKey | ANPBOISEUINWQC-QGHHPUGFSA-N |
| XLogP | 5.71 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |